H-Lys-Lys-OH Hydrochloride salt structure
|
Common Name | H-Lys-Lys-OH Hydrochloride salt | ||
|---|---|---|---|---|
| CAS Number | 13184-13-9 | Molecular Weight | 274.36000 | |
| Density | 1.148g/cm3 | Boiling Point | 558.6ºC at 760mmHg | |
| Molecular Formula | C12H26N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.6ºC | |
| Name | Lys-Lys |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 558.6ºC at 760mmHg |
| Molecular Formula | C12H26N4O3 |
| Molecular Weight | 274.36000 |
| Flash Point | 291.6ºC |
| Exact Mass | 274.20000 |
| PSA | 144.46000 |
| LogP | 1.63290 |
| Vapour Pressure | 6.07E-14mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | NVGBPTNZLWRQSY-UWVGGRQHSA-N |
| SMILES | NCCCCC(N)C(=O)NC(CCCCN)C(=O)O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Arginine,L-lysyl |
| lysyl-lysine |
| lysyllysine |
| L-Lys-L-Arg |
| lysylarginine |
| L-lysyl-L-arginine |
| N2-L-lysyl-L-lysine |
| L-Lysyl=>L-arginin |