4-(Bromomethyl)-2-fluoro-1-nitrobenzene structure
|
Common Name | 4-(Bromomethyl)-2-fluoro-1-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 131858-37-2 | Molecular Weight | 234.023 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 311.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H5BrFNO2 | Melting Point | 46-48°C | |
| MSDS | N/A | Flash Point | 142.3±23.7 °C | |
| Name | 4-(bromomethyl)-2-fluoro-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 311.6±27.0 °C at 760 mmHg |
| Melting Point | 46-48°C |
| Molecular Formula | C7H5BrFNO2 |
| Molecular Weight | 234.023 |
| Flash Point | 142.3±23.7 °C |
| Exact Mass | 232.948761 |
| PSA | 45.82000 |
| LogP | 2.39 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | ZOZJSWIXPIVMRU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CBr)cc1F |
| Hazard Codes | C:Corrosive |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 1759 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~89%
4-(Bromomethyl)... CAS#:131858-37-2 |
| Literature: Beugelmans, Rene; Gonzalez Zamora, Eduardo; Roussi, Georges Tetrahedron Letters, 1997 , vol. 38, # 47 p. 8189 - 8192 |
|
~72%
4-(Bromomethyl)... CAS#:131858-37-2 |
| Literature: ABBOTT LABORATORIES Patent: WO2009/39135 A1, 2009 ; Location in patent: Page/Page column 110-111 ; |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD03094237 |
| WNR BF D1E |
| 4-(Bromomethyl)-2-fluoro-1-nitrobenzene |
| 3-Fluoro-4-nitrobenzyl bromide |
| Benzene, 4-(bromomethyl)-2-fluoro-1-nitro- |
| 3-fluoro-4-nitro-benzylbromide |
| 4-bromomethyl-2-fluoro-1-nitro-benzene |
| 3-FLUORO-4-NITROBENZYLBROMIDE |