Propanoic acid,2-(2-nitrophenoxy)- structure
|
Common Name | Propanoic acid,2-(2-nitrophenoxy)- | ||
|---|---|---|---|---|
| CAS Number | 13212-57-2 | Molecular Weight | 211.17100 | |
| Density | 1.377g/cm3 | Boiling Point | 384.9ºC at 760 mmHg | |
| Molecular Formula | C9H9NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.6ºC | |
| Name | 2-(2-nitrophenoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 384.9ºC at 760 mmHg |
| Molecular Formula | C9H9NO5 |
| Molecular Weight | 211.17100 |
| Flash Point | 186.6ºC |
| Exact Mass | 211.04800 |
| PSA | 92.35000 |
| LogP | 1.96990 |
| Vapour Pressure | 1.3E-06mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | MALMTWYTOBLCBT-UHFFFAOYSA-N |
| SMILES | CC(Oc1ccccc1[N+](=O)[O-])C(=O)O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Nitro-phenylaethermilchsaeure |