PyBroP structure
|
Common Name | PyBroP | ||
|---|---|---|---|---|
| CAS Number | 132705-51-2 | Molecular Weight | 466.18100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24BrF6N3P2 | Melting Point | 100 °C | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | Bromotri(1-Pyrrolidinyl)Phosphonium Hexafluorophosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 100 °C |
|---|---|
| Molecular Formula | C12H24BrF6N3P2 |
| Molecular Weight | 466.18100 |
| Exact Mass | 465.05300 |
| PSA | 36.90000 |
| LogP | 6.54240 |
| InChIKey | CYKRMWNZYOIJCH-UHFFFAOYSA-N |
| SMILES | Br[P+](N1CCCC1)(N1CCCC1)N1CCCC1.F[P-](F)(F)(F)(F)F |
| Storage condition | −20°C |
| Water Solubility | moderately soluble |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
~%
PyBroP CAS#:132705-51-2 |
| Literature: Journal of Organic Chemistry, , vol. 59, # 9 p. 2437 - 2446 |
|
~%
PyBroP CAS#:132705-51-2 |
| Literature: Journal of Organic Chemistry, , vol. 59, # 9 p. 2437 - 2446 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Non-covalent photo-patterning of gelatin matrices using caged collagen mimetic peptides.
Macromol. Biosci. 15(1) , 52-62, (2015) To address the downside of conventional photo-patterning which can alter the chemical composition of protein scaffolds, we developed a non-covalent photo-patterning strategy for gelatin (denatured col... |
|
|
General and mild preparation of 2-aminopyridines.
Org. Lett. 12(22) , 5254-7, (2010) A general and facile one-pot amination procedure for the synthesis of 2-aminopyridines from the corresponding pyridine-N-oxides is presented as a mild alternative to S(N)Ar chemistry. A variety of ami... |
|
|
J. Coste et al.
J. Org. Chem. 59 , 2437, (1994)
|
| PyBrOP;; Bromo-tris-pyrrolidino phosphoniumhexafluorophosphate |
| Bromo(tripyrrolidin-1-yl)phosphonium hexafluorophosphate |
| Bromotri(pyrrolidin-1-yl)phosphonium hexafluorophosphate(V) |
| Bromo[tri(pyrrolidin-1-yl)]phosphonium hexafluorophosphate |
| Bromo-tris-pyrrolidino phosphoniumhexafluorophosphate |
| Bromo(tri-1-pyrrolidinyl)phosphonium hexafluorophosphate |
| Bromo-tris-pyrrolidinophosphonium hexafluorophosphate |
| Bromo-Tris-Pyrrolidinophosphoniumhexafluorophosphate |
| Bromotripyrrolidinophosphonium hexafluorophosphate |
| bromo(tripyrrolidin-1-yl)phosphanium,hexafluorophosphate |
| Bromo-tris-pyrrolidino-phosphonium hexafluorophpsphate |
| MFCD00077412 |
| PyBroP |
| BROMO-TRIS-PYRROLIDINO-PHOSPHONIUM HEXAFLUOROPHOSPHATE |