LEE011-D6 structure
|
Common Name | LEE011-D6 | ||
|---|---|---|---|---|
| CAS Number | 1328934-40-2 | Molecular Weight | 440.57 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24D6N8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of LEE011-D6Ribociclib D6 (LEE011 D6) is a deuterium labeled Ribociclib. Ribociclib is a highly specific CDK4/6 inhibitor with IC50 values of 10 nM and 39 nM, respectively, and is over 1,000-fold less potent against the cyclin B/CDK1 complex[1]. |
| Name | Ribociclib D6 |
|---|
| Description | Ribociclib D6 (LEE011 D6) is a deuterium labeled Ribociclib. Ribociclib is a highly specific CDK4/6 inhibitor with IC50 values of 10 nM and 39 nM, respectively, and is over 1,000-fold less potent against the cyclin B/CDK1 complex[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C23H24D6N8O |
|---|---|
| Molecular Weight | 440.57 |
| InChIKey | RHXHGRAEPCAFML-WFGJKAKNSA-N |
| SMILES | CN(C)C(=O)c1cc2cnc(Nc3ccc(N4CCNCC4)cn3)nc2n1C1CCCC1 |