γ-Tocopherol-d4 structure
|
Common Name | γ-Tocopherol-d4 | ||
|---|---|---|---|---|
| CAS Number | 1329652-13-2 | Molecular Weight | 420.70 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H44D4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of γ-Tocopherol-d4γ-Tocopherol-d4 (D-γ-Tocopherol-d4) is the deuterium labeled γ-Tocopherol. γ-Tocopherol (D-γ-Tocopherol) is a potent cyclooxygenase (COX) inhibitor. γ-Tocopherol is a naturally occurring form of Vitamin E in many plant seeds, such as corn oil and soybeans. γ-Tocopherol possesses antiinflammatory properties and anti-cancer activity[1][2]. |
| Name | γ-Tocopherol-d4 |
|---|
| Description | γ-Tocopherol-d4 (D-γ-Tocopherol-d4) is the deuterium labeled γ-Tocopherol. γ-Tocopherol (D-γ-Tocopherol) is a potent cyclooxygenase (COX) inhibitor. γ-Tocopherol is a naturally occurring form of Vitamin E in many plant seeds, such as corn oil and soybeans. γ-Tocopherol possesses antiinflammatory properties and anti-cancer activity[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C28H44D4O2 |
|---|---|
| Molecular Weight | 420.70 |
| InChIKey | QUEDXNHFTDJVIY-HYPXHKDHSA-N |
| SMILES | Cc1c(O)cc2c(c1C)OC(C)(CCCC(C)CCCC(C)CCCC(C)C)CC2 |