Uridine diphosphate glucose structure
|
Common Name | Uridine diphosphate glucose | ||
|---|---|---|---|---|
| CAS Number | 133-89-1 | Molecular Weight | 566.30200 | |
| Density | 1.97 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H24N2O17P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Uridine diphosphate glucoseUridine diphosphate glucose is an important intermediate in several different metabolic pathways and biosynthetic reactions, including the biosynthesis of polysaccharides such as starch and glycogen, lipopolysaccharides, and glycosphingolipids. |
| Name | UDP-D-glucose |
|---|---|
| Synonym | More Synonyms |
| Description | Uridine diphosphate glucose is an important intermediate in several different metabolic pathways and biosynthetic reactions, including the biosynthesis of polysaccharides such as starch and glycogen, lipopolysaccharides, and glycosphingolipids. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
[1]. PALADINI AC, et al. Studies on uridine-diphosphate-glucose. Biochem J. 1952 Jun;51(3):426-30. |
| Density | 1.97 g/cm3 |
|---|---|
| Molecular Formula | C15H24N2O17P2 |
| Molecular Weight | 566.30200 |
| Exact Mass | 566.05500 |
| PSA | 327.61000 |
| Index of Refraction | 1.673 |
| InChIKey | HSCJRCZFDFQWRP-JZMIEXBBSA-N |
| SMILES | O=c1ccn(C2OC(COP(=O)(O)OP(=O)(O)OC3OC(CO)C(O)C(O)C3O)C(O)C2O)c(=O)[nH]1 |
| Storage condition | 2-8℃ |
| [[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl] [(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] hydrogen phosphate |
| Uridine diphosphoglucose |
| UDP-g,ucuronic acid |
| UDP glucuronic acid |
| URIDINE-5'-DIPHOSPHATE-GLUCOSE |
| [3H]-Uridine diphosphate glucose |
| URIDINE DIPHOSPHATE GLUCOSE |
| UDP-glucose |
| UDPG |