Resveratroloside structure
|
Common Name | Resveratroloside | ||
|---|---|---|---|---|
| CAS Number | 38963-95-0 | Molecular Weight | 404.36700 | |
| Density | 1.521±0.06 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H22O8 | Melting Point | 235-238 ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of ResveratrolosideResveratroloside is a competitive inhibitior of α-glucosidase with an IC50 of 22.9 μM. Resveratroloside has the ability to regulate PBG (postprandial blood glucose) levels. Resveratroloside exhibits cardioprotective effect[1][2]. |
| Name | (2S,3R,4S,5S,6R)-2-[4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| Synonym | More Synonyms |
| Description | Resveratroloside is a competitive inhibitior of α-glucosidase with an IC50 of 22.9 μM. Resveratroloside has the ability to regulate PBG (postprandial blood glucose) levels. Resveratroloside exhibits cardioprotective effect[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.521±0.06 g/cm3 |
|---|---|
| Melting Point | 235-238 ºC |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 404.36700 |
| Exact Mass | 404.11100 |
| PSA | 156.91000 |
| LogP | 0.53920 |
| InChIKey | RUOKEYJFAJITAG-CUYWLFDKSA-N |
| SMILES | OCC1OC(Oc2ccc(C=Cc3cc(O)cc(O)c3)cc2)C(O)C(O)C1O |
| Water Solubility | Slightly soluble (1.7 g/L) (25 ºC) |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| Resveratrol (3,4',5-trihydroxystilbene) |
| trans-resveratroloside |
| Resveratroloside |
| GOB C |
| B-D-glucopyranoside,4-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]phenyl |
| BIDD:ER0104 |
| Resveratrol 4'-Glucoside |
| Resveratrol 4'-O-beta-D-glucopyranoside |