Fmoc-N-Me-Tyr(tBu)-OH structure
|
Common Name | Fmoc-N-Me-Tyr(tBu)-OH | ||
|---|---|---|---|---|
| CAS Number | 133373-24-7 | Molecular Weight | 473.560 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 638.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C29H31NO5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 340.2±31.5 °C | |
| Name | Fmoc-Nalpha-methyl-O-t-butyl-L-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 638.9±55.0 °C at 760 mmHg |
| Molecular Formula | C29H31NO5 |
| Molecular Weight | 473.560 |
| Flash Point | 340.2±31.5 °C |
| Exact Mass | 473.220215 |
| PSA | 76.07000 |
| LogP | 7.04 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | WTLSDEYZKFJXFT-SANMLTNESA-N |
| SMILES | CN(C(=O)OCC1c2ccccc2-c2ccccc21)C(Cc1ccc(OC(C)(C)C)cc1)C(=O)O |
| Storage condition | Store at 0-5°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2922509090 |
|
~80%
Fmoc-N-Me-Tyr(t... CAS#:133373-24-7 |
| Literature: Leggio, Antonella; Belsito, Emilia Lucia; De Marco, Rosaria; Liguori, Angelo; Perri, Francesca; Viscomi, Maria Caterina Journal of Organic Chemistry, 2010 , vol. 75, # 5 p. 1386 - 1392 |
|
~71%
Fmoc-N-Me-Tyr(t... CAS#:133373-24-7 |
| Literature: Di Gioia, Maria Luisa; Leggio, Antonella; Liguori, Angelo; Perri, Francesca Journal of Organic Chemistry, 2007 , vol. 72, # 10 p. 3723 - 3728 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| O-tert-Butyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-tyrosine |
| (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoic acid |
| Fmoc-N-Me-Tyr(tBu)-OH |
| N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-O-(2-methyl-2-propanyl)-L-tyrosine |
| MFCD02684471 |
| Fmoc-N-methyl-O-t-butyl-L-tyrosine |
| L-Tyrosine, O-(1,1-dimethylethyl)-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-N-methyl- |