Isovalerylcarnitine-d9 chloride structure
|
Common Name | Isovalerylcarnitine-d9 chloride | ||
|---|---|---|---|---|
| CAS Number | 1334532-23-8 | Molecular Weight | 290.83 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15D9ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Isovalerylcarnitine-d9 chlorideIsovalerylcarnitine-d9 (chloride) is the deuterium labeled Isovalerylcarnitine (chloride)[1]. Isovalerylcarnitine chloride, a product of the catabolism of L-leucine, is a potent activator of the Ca2+-dependent proteinase (calpain) of human neutrophils[2]. |
| Name | Isovaleryl L-Carnitine-d9 Chloride |
|---|---|
| Synonym | More Synonyms |
| Description | Isovalerylcarnitine-d9 (chloride) is the deuterium labeled Isovalerylcarnitine (chloride)[1]. Isovalerylcarnitine chloride, a product of the catabolism of L-leucine, is a potent activator of the Ca2+-dependent proteinase (calpain) of human neutrophils[2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C12H15D9ClNO4 |
|---|---|
| Molecular Weight | 290.83 |
| Exact Mass | 290.195862 |
| InChIKey | HWDFIOSIRGUUSM-UGYZPRMBSA-N |
| SMILES | CC(C)CC(=O)OC(CC(=O)O)C[N+](C)(C)C.[Cl-] |
| (2R)-3-Carboxy-N,N,N-trimethyl-2-(3-methyl-1-oxobutoxy)-1-propanaminium-d9 Chloride |
| (2R)-3-Carboxy-N,N,N-tris[(2H3)methyl]-2-[(3-methylbutanoyl)oxy]-1-propanaminium chloride |
| 1-Propanaminium, 3-carboxy-N,N,N-tri(methyl-d3)-2-(3-methyl-1-oxobutoxy)-, chloride (1:1), (2R)- |
| 1-Propanaminium, 3-carboxy-N,N,N-tri(methyl-d3)-2-(3-methyl-1-oxobutoxy)-, chloride, (2R)- (1:1) |
| (R)-3-Carboxy-N,N,N-trimethyl-2-(3-methyl-1-oxobutoxy)-1-propanaminium-d9 Chloride |