WWL154
Modify Date: 2025-08-25 12:49:46
WWL154 structure
|
Common Name | WWL154 | ||
|---|---|---|---|---|
| CAS Number | 1338574-93-8 | Molecular Weight | 357.36 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 553.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H19N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.6±30.1 °C | |
Use of WWL154WWL154, an analog of JZL184 that maintains the SH-reactive p-nitrophenyl carbamate group, is a FAAH-4 inhibitor[1]. |
| Name | 4-Nitrophenyl 4-(4-methoxyphenyl)-1-piperazinecarboxylate |
|---|---|
| Synonym | More Synonyms |
| Description | WWL154, an analog of JZL184 that maintains the SH-reactive p-nitrophenyl carbamate group, is a FAAH-4 inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 553.6±50.0 °C at 760 mmHg |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.36 |
| Flash Point | 288.6±30.1 °C |
| Exact Mass | 357.132477 |
| LogP | 3.21 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | TULVXRNEEQWFGU-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(C(=O)Oc3ccc([N+](=O)[O-])cc3)CC2)cc1 |
| Hazard Codes | Xn |
|---|
| 1-Piperazinecarboxylic acid, 4-(4-methoxyphenyl)-, 4-nitrophenyl ester |
| 4-Nitrophenyl 4-(4-methoxyphenyl)-1-piperazinecarboxylate |