Bis(4-cyanophenyl)methanol structure
|
Common Name | Bis(4-cyanophenyl)methanol | ||
|---|---|---|---|---|
| CAS Number | 134521-16-7 | Molecular Weight | 234.253 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 473.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.1±28.7 °C | |
| Name | Bis(4-Cyanophenyl)Methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 473.5±45.0 °C at 760 mmHg |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.253 |
| Flash Point | 240.1±28.7 °C |
| Exact Mass | 234.079315 |
| PSA | 67.81000 |
| LogP | 1.62 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | JNJWXPZHWUOYRZ-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(C(O)c2ccc(C#N)cc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2926909090 |
|
~%
Bis(4-cyanophen... CAS#:134521-16-7 |
| Literature: Journal of the Chemical Society, , p. 103,107 |
|
~%
Bis(4-cyanophen... CAS#:134521-16-7 |
| Literature: Journal of the Chemical Society, , p. 103,107 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD07367966 |
| 4,4'-(hydroxymethanediyl)dibenzonitrile |
| Bis(4-cyanophenyl)methanol |
| 4-[(4-cyanophenyl)-hydroxymethyl]benzonitrile |
| 4,4'-(Hydroxymethylene)dibenzonitrile |
| 4,4'-Dicyanobenzhydrol |
| Benzonitrile, 4,4'-(hydroxymethylene)bis- |