4,4'-Diaminobenzophenone structure
|
Common Name | 4,4'-Diaminobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 611-98-3 | Molecular Weight | 212.247 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 452.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C13H12N2O | Melting Point | 243-247 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 227.7±24.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,4'-Diaminobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.8±30.0 °C at 760 mmHg |
| Melting Point | 243-247 °C(lit.) |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.247 |
| Flash Point | 227.7±24.6 °C |
| Exact Mass | 212.094955 |
| PSA | 69.11000 |
| LogP | 1.66 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | ZLSMCQSGRWNEGX-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)c2ccc(N)cc2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922399090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
In vivo evaluation of diaminodiphenyls: anticonvulsant agents with minimal acute neurotoxicity.
Bioorg. Med. Chem. Lett. 19 , 5012-5, (2009) Several diaminodiphenyl analogs were assessed in vivo for their capacity to inhibit seizure induction and propagation in rodents. Both 3,4'- and 4,4'-diaminodiphenyl compounds prevented seizures for a... |
| 4,4'-Diaminobenzophenone |
| MFCD00038138 |
| Bis(4-aminophenyl)methanone |
| Methanone, bis(4-aminophenyl)- |