Esmolol-d7 (hydrochloride) structure
|
Common Name | Esmolol-d7 (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 1346598-13-7 | Molecular Weight | 338.878 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H19D7ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Esmolol-d7 (hydrochloride)Esmolol-d7 hydrochloride is the deuterium labeled Esmolol hydrochloride. Esmolol hydrochloride is a beta adrenergic receptor blocker[1][2]. |
| Name | Esmolol-d7 (hydrochloride) |
|---|---|
| Synonym | More Synonyms |
| Description | Esmolol-d7 hydrochloride is the deuterium labeled Esmolol hydrochloride. Esmolol hydrochloride is a beta adrenergic receptor blocker[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C16H19D7ClNO4 |
|---|---|
| Molecular Weight | 338.878 |
| Exact Mass | 338.198975 |
| InChIKey | GEKNCWBANDDJJL-ODLOEXKQSA-N |
| SMILES | COC(=O)CCc1ccc(OCC(O)CNC(C)C)cc1.Cl |
| Benzenepropanoic acid, 4-[2-hydroxy-3-[[1-(methyl-d3)ethyl-1,2,2,2-d4]amino]propoxy]-, methyl ester, hydrochloride (1:1) |
| Esmolol-d7 (hydrochloride) |
| Methyl 3-(4-{2-hydroxy-3-[(2H7)-2-propanylamino]propoxy}phenyl)propanoate hydrochloride (1:1) |