2,2'-azobis(2-methylbutyronitrile) structure
|
Common Name | 2,2'-azobis(2-methylbutyronitrile) | ||
|---|---|---|---|---|
| CAS Number | 13472-08-7 | Molecular Weight | 192.261 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 273.0±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H16N4 | Melting Point | 49-52 °C | |
| MSDS | N/A | Flash Point | 118.9±23.2 °C | |
| Name | 2,2-Azodi(2-Methylbutyronitrile) |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 273.0±25.0 °C at 760 mmHg |
| Melting Point | 49-52 °C |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.261 |
| Flash Point | 118.9±23.2 °C |
| Exact Mass | 192.137497 |
| PSA | 72.30000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.490 |
| InChIKey | AVTLBBWTUPQRAY-UHFFFAOYSA-N |
| SMILES | CCC(C)(C#N)N=NC(C)(C#N)CC |
| Storage condition | 2-8°C |
| Stability | Explosive. Risk of explosion if struck, ground or heated. Highly flammable. Incompatible with strong oxidizing agents. |
| Hazard Codes | F:Flammable;Xn:Harmful; |
|---|---|
| Risk Phrases | R11;R22 |
| Safety Phrases | 47 |
| RIDADR | UN 3236 4.1 |
| WGK Germany | 1 |
| RTECS | EK4818750 |
| Packaging Group | II |
| Hazard Class | 4.1 |
| HS Code | 2927000090 |
|
~92%
2,2'-azobis(2-m... CAS#:13472-08-7 |
| Literature: Mohite; Desai, Uday V.; Pore; Mane; Wadgaonkar Journal of Chemical Research, 2004 , # 9 p. 645 - 646 |
|
~%
2,2'-azobis(2-m... CAS#:13472-08-7 |
| Literature: Zhurnal Organicheskoi Khimii, , vol. 7, p. 2263 - 2267,2354 - 2357 |
|
~%
2,2'-azobis(2-m... CAS#:13472-08-7 |
| Literature: US2713576 , ; DRP/DRBP Org.Chem. DE849109 , ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,2'-(E)-diazene-1,2-diylbis(2-methylbutanenitrile) |
| 2,2′-Azobis(2-methylbutyronitrile) |
| 2,2'-azobis(2-methylbutyronitrile) |
| Butanenitrile, 2,2'-[(E)-1,2-diazenediyl]bis[2-methyl- |
| 2,2'-Azodi(2-methylbutyronitrile) |
| MFCD00080408 |
| 2,2'-[(E)-1,2-Diazenediyl]bis(2-methylbutanenitrile) |
| 2,2'-(Diazene-1,2-diyl)bis(2-methylbutanenitrile) |
| EINECS 236-740-8 |
| Butanenitrile, 2,2'-azobis[2-methyl- |