2,2'-Azobis(2-methylpropionamidine) dihydrochloride structure
|
Common Name | 2,2'-Azobis(2-methylpropionamidine) dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2997-92-4 | Molecular Weight | 271.191 | |
| Density | 0.42 | Boiling Point | 267ºC at 760 mmHg | |
| Molecular Formula | C8H20Cl2N6 | Melting Point | 160-169 ºC | |
| MSDS | Chinese USA | Flash Point | 115.3ºC | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
Use of 2,2'-Azobis(2-methylpropionamidine) dihydrochlorideAAPH (2,2'-Azodiisobutyramidine dihydrochloride) has an effect of radical generation. AAPH induces oxidative stress and erythrocyte hemolysis[1]. |
| Name | 2,2'-Azobis(2-methylpropionamidine) dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | AAPH (2,2'-Azodiisobutyramidine dihydrochloride) has an effect of radical generation. AAPH induces oxidative stress and erythrocyte hemolysis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 0.42 |
|---|---|
| Boiling Point | 267ºC at 760 mmHg |
| Melting Point | 160-169 ºC |
| Molecular Formula | C8H20Cl2N6 |
| Molecular Weight | 271.191 |
| Flash Point | 115.3ºC |
| Exact Mass | 270.112640 |
| PSA | 124.46000 |
| LogP | 4.07180 |
| Vapour Pressure | 8.02E-05mmHg at 25°C |
| InChIKey | LXEKPEMOWBOYRF-UHFFFAOYSA-N |
| SMILES | CC(C)(N=NC(C)(C)C(=N)N)C(=N)N.Cl.Cl |
| Stability | Unstable. Sensitive to heat and light. Incompatible with strong oxidizing agents, strong acids. |
| Water Solubility | acetone, dioxane, methanol, ethanol, DMSO and water: soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H242-H302-H317 |
| Precautionary Statements | P280 |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R43 |
| Safety Phrases | S24-S37 |
| RIDADR | UN 3226 4.1 |
| WGK Germany | 1 |
| RTECS | UE4575500 |
| Packaging Group | III |
| Hazard Class | 5.1 |
|
Antioxidant activity of protocatechuates evaluated by DPPH, ORAC, and CAT methods.
Food Chem. 194 , 749-57, (2015) Hibiscus sabdariffa L. is a worldwide consumed plant, principally after infusion of its dried sepals and calyces, which are usually discarded. Nevertheless, they represent a potential source of natura... |
|
|
Antioxidant and antiproliferative activities of polysaccharide fractions from litchi pulp.
Food Funct. 6 , 2598-606, (2015) Three litchi polysaccharide fractions (LPFs), LP-4, LP-6 and LP-8, were obtained by fractional precipitation using 40%, 60% and 80% ethanol, respectively. The physicochemical properties, chemical anti... |
|
|
Antioxidant and anti-ageing activities of citrus-based juice mixture.
Food Chem. 194 , 920-7, (2015) The production of excessive reactive oxygen species by exposure to oxidative stress and solar radiation are primary factors in skin damage. We examined the effects of a citrus-based juice mixture and ... |
| 2,2-AZOBIS-(2-AMIDINOPROPANE) HCL |
| AAPH |
| Azostarter V 50 |
| ms1 |
| ABAP |
| 2,2-Azobis(2-Methylpropionamidine) Dihydrochloride |
| ms1(catalyst) |
| v50 |
| 2,2'-Azobis(2 |
| 2,2′-azobis(isobutyramidine) dihydrochloride |
| Propanimidamide, 2,2'-[(E)-1,2-diazenediyl]bis[2-methyl-, hydrochloride (1:2) |
| 2,2‘-Azobis(2-methylpropionamidine) dihydrochloride |
| 2,2'-azobis(2-methyl-2-propionamidine) dihydrochloride |
| 2,2'-azobisi(2-amidinopropane) hydrochloride |
| 2,2'-Azobis(2-methylpropionamidine) Dihydrochloride |
| 2,2'-(Diazene-1,2-diyl)bis(2-methylpropanimidamide) dihydrochloride |
| 2,2'-(e)-diazene-1,2-diylbis(2-methylpropanimidamide) dihydrochloride |
| EINECS 221-070-0 |
| 2,2’-Azodiisobutyramidine Dihydrochloride |
| MFCD00142725 |
| 2,2'-[(E)-1,2-Diazenediyl]bis(2-methylpropanimidamide) dihydrochloride |
| 2,2'-Azobis-amidinopropane |
| AIBA |
| 2,2'-(3-NITROPHENYLIMINO)-DIETHANOL |
| 2,2'-Azobis(isobutyramidine) 2HCl |