5WKS structure
|
Common Name | 5WKS | ||
|---|---|---|---|---|
| CAS Number | 1350752-07-6 | Molecular Weight | 462.028 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 529.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H36ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.9±30.1 °C | |
Use of 5WKSG9a-IN-1 (Compound 113) is a G9a protein inhibitor. G9A/EHMT2 is a nuclear histone lysine methyltransferase that catalyzes histone H3 lysine 9 dimethylation (H3K9me2), which is a reversible modification generally associated with transcriptional gene silencing. G9a-IN-1 can be used for the research of autoimmune disorders or cancer[1]. |
| Name | 2-Chloro-N-(1-isopropyl-4-piperidinyl)-6-methoxy-7-[3-(1-pyrrolidinyl)propoxy]-4-quinazolinamine |
|---|---|
| Synonym | More Synonyms |
| Description | G9a-IN-1 (Compound 113) is a G9a protein inhibitor. G9A/EHMT2 is a nuclear histone lysine methyltransferase that catalyzes histone H3 lysine 9 dimethylation (H3K9me2), which is a reversible modification generally associated with transcriptional gene silencing. G9a-IN-1 can be used for the research of autoimmune disorders or cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.3±50.0 °C at 760 mmHg |
| Molecular Formula | C24H36ClN5O2 |
| Molecular Weight | 462.028 |
| Flash Point | 273.9±30.1 °C |
| Exact Mass | 461.255768 |
| LogP | 4.89 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | GHTIAKXLWWMKSI-UHFFFAOYSA-N |
| SMILES | COc1cc2c(NC3CCN(C(C)C)CC3)nc(Cl)nc2cc1OCCCN1CCCC1 |
| 2-Chloro-N-(1-isopropyl-4-piperidinyl)-6-methoxy-7-[3-(1-pyrrolidinyl)propoxy]-4-quinazolinamine |
| 4-Quinazolinamine, 2-chloro-6-methoxy-N-[1-(1-methylethyl)-4-piperidinyl]-7-[3-(1-pyrrolidinyl)propoxy]- |