UDP-glucosamine disodium structure
|
Common Name | UDP-glucosamine disodium | ||
|---|---|---|---|---|
| CAS Number | 1355005-51-4 | Molecular Weight | 609.28 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23N3Na2O16P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of UDP-glucosamine disodiumUDP-glucosamine (UDP-GlcNAc) disodium is a substrate for O-GlcNAc transferase, which catalyzes the attachment of O-GlcNAc to proteins. O-GlcNAcase catalyzes the removal of O-GlcNAc from proteins. UDP-glucosamine (UDP-GlcNAc) disodium is the end product of the hexosamine biosynthesis pathway, which is regulated primarily by glucose-6-phosphate-Glutamine:fructose-6-phosphate amidotransferase (GFAT)[1]. |
| Name | UDP-glucosamine disodium |
|---|
| Description | UDP-glucosamine (UDP-GlcNAc) disodium is a substrate for O-GlcNAc transferase, which catalyzes the attachment of O-GlcNAc to proteins. O-GlcNAcase catalyzes the removal of O-GlcNAc from proteins. UDP-glucosamine (UDP-GlcNAc) disodium is the end product of the hexosamine biosynthesis pathway, which is regulated primarily by glucose-6-phosphate-Glutamine:fructose-6-phosphate amidotransferase (GFAT)[1]. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Molecular Formula | C15H23N3Na2O16P2 |
|---|---|
| Molecular Weight | 609.28 |
| InChIKey | OYUJNUWEWMWPBM-CZILZAFRSA-L |
| SMILES | NC1C(OP(=O)([O-])OP(=O)([O-])OCC2OC(n3ccc(=O)[nH]c3=O)C(O)C2O)OC(CO)C(O)C1O.[Na+].[Na+] |