CYM50179 structure
|
Common Name | CYM50179 | ||
|---|---|---|---|---|
| CAS Number | 1355026-47-9 | Molecular Weight | 441.93 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 508.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C13H9Br2Cl2NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 261.3±30.1 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
Use of CYM50179CYM50179 (compound 22n) is a potent and selective S1P4-R (Sphingosine-1-phosphate4 receptor) agonist with an EC50 of 46 nM[1]. |
| Name | ML-178 |
|---|---|
| Synonym | More Synonyms |
| Description | CYM50179 (compound 22n) is a potent and selective S1P4-R (Sphingosine-1-phosphate4 receptor) agonist with an EC50 of 46 nM[1]. |
|---|---|
| Related Catalog | |
| Target |
S1PR4:46 nM (EC50) |
| References |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 508.5±50.0 °C at 760 mmHg |
| Molecular Formula | C13H9Br2Cl2NO2 |
| Molecular Weight | 441.93 |
| Flash Point | 261.3±30.1 °C |
| Exact Mass | 438.837708 |
| LogP | 5.62 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.620 |
| InChIKey | KMGUBUXDNOMSRM-UHFFFAOYSA-N |
| SMILES | Clc1ccc(OCCOc2ccc(Br)nc2Br)c(Cl)c1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H318-H413 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2811 6.1 / PGIII |
| 2,6-Dibromo-3-[2-(2,4-dichlorophenoxy)ethoxy]pyridine |
| Pyridine, 2,6-dibromo-3-[2-(2,4-dichlorophenoxy)ethoxy]- |
| ML-178 |