Boc-L-Glutamic acid 5-benzylester structure
|
Common Name | Boc-L-Glutamic acid 5-benzylester | ||
|---|---|---|---|---|
| CAS Number | 13574-13-5 | Molecular Weight | 337.37 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 522.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H23NO6 | Melting Point | 65-68ºC | |
| MSDS | Chinese USA | Flash Point | 269.9±30.1 °C | |
Use of Boc-L-Glutamic acid 5-benzylesterBoc-Glu(OBzl)-OH is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Boc-Glu(OBzl)-OH |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Glu(OBzl)-OH is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 522.6±50.0 °C at 760 mmHg |
| Melting Point | 65-68ºC |
| Molecular Formula | C17H23NO6 |
| Molecular Weight | 337.37 |
| Flash Point | 269.9±30.1 °C |
| Exact Mass | 337.152527 |
| PSA | 101.93000 |
| LogP | 3.34 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | AJDUMMXHVCMISJ-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)OCc1ccccc1)C(=O)O |
| Storage condition | 2~8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2S)-5-(Benzyloxy)-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid |
| N-α-tert-BOC-L-glutamic-γ-benzyl ester |
| (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-phenylmethoxypentanoic acid |
| (2S)-5-(Benzyloxy)-2-[(tert-butoxycarbonyl)amino]-5-oxopentanoic acid (non-preferred name) |
| 5-Benzyl N-(tert-Butoxycarbonyl)-L-glutamate |
| Boc-Glu(Obzl)-OH |
| N-Boc-L-glutamic Acid 5-Benzyl Ester |
| N-(tert-Butoxycarbonyl)-L-glutamic acid 5-benzyl ester |
| L-Glutamic acid, N-[(1,1-dimethylethoxy)carbonyl]-, 5-(phenylmethyl) ester |
| Boc-L-glutamic acid 5-benzyl ester |
| Boc-L-Glutamic acid 5-benzylester |
| MFCD00065569 |
| 5-Benzyl N-Boc-L-glutamate |
| EINECS 237-007-5 |