Cobalt bis(2-ethylhexanoate) structure
|
Common Name | Cobalt bis(2-ethylhexanoate) | ||
|---|---|---|---|---|
| CAS Number | 136-52-7 | Molecular Weight | 345.340 | |
| Density | 1.01 | Boiling Point | 228ºC at 760mmHg | |
| Molecular Formula | C16H30CoO4 | Melting Point | 38ºC | |
| MSDS | Chinese | Flash Point | 116.6ºC | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | Cobalt bis(2-ethylhexanoate) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01 |
|---|---|
| Boiling Point | 228ºC at 760mmHg |
| Melting Point | 38ºC |
| Molecular Formula | C16H30CoO4 |
| Molecular Weight | 345.340 |
| Flash Point | 116.6ºC |
| Exact Mass | 345.147614 |
| PSA | 80.26000 |
| LogP | 1.90540 |
| Index of Refraction | 1.5748 (25ºC) |
| InChIKey | QAEKNCDIHIGLFI-UHFFFAOYSA-L |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Co+2] |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H226-H304-H317-H319-H361-H410 |
| Supplemental HS | Repeated exposure may cause skin dryness or cracking. |
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P331-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R10;R36/37/38;R40;R43 |
| Safety Phrases | S26-S36/37 |
| RIDADR | UN 1268 |
| WGK Germany | 3 |
|
~%
Cobalt bis(2-et... CAS#:136-52-7 |
| Literature: Canadian Journal of Chemistry, , vol. 65, p. 740 - 743 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Offset printer's occupational allergic contact dermatitis caused by cobalt-2-ethylhexoate.
Contact Dermatitis 34(1) , 67-8, (1996)
|
|
|
Occupational allergic contact dermatitis to cobalt octoate included as an accelerator in a polyester resin.
Australas. J. Dermatol. 47(2) , 143-4, (2006) A 46-year-old woman, who worked as a laminator of spa baths, presented with hand dermatitis, which was suspected to be related to her occupation. Patch testing revealed strong reactions to both cobalt... |
|
|
Occupational cobalt-allergic contact dermatitis resulting from polyester resin.
Contact Dermatitis 63(5) , 292-4, (2010)
|
| Hexanoic acid, 2-ethyl-, cobalt(2+) salt (2:1) |
| cobalt 2,3-naphthalocyanine |
| 2,3-naphthalianine,cobalt complex |
| cobalt 2-ethyl-hexanoate |
| Cobalt(II) 2-ethylhexanoate |
| cobaltous chloride |
| MFCD00072632 |
| anhydrous cobalt chloride |
| Cobaltchloride |
| Cobalt chloride 0.1 M solution |
| Cobalt 2-ethylhexanoate |
| Cobalt(2+) bis(2-ethylhexanoate) |
| cobalt ethylhexanoate |
| EINECS 205-250-6 |
| cobalt 2-ethylcaproate |
| WLN: CO G2 |