Arofylline structure
|
Common Name | Arofylline | ||
|---|---|---|---|---|
| CAS Number | 136145-07-8 | Molecular Weight | 304.73200 | |
| Density | 1.429g/cm3 | Boiling Point | 562.6ºC at 760 mmHg | |
| Molecular Formula | C14H13ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294ºC | |
Use of ArofyllineArofylline is a PDE4 inhibitor as a potential treatment for asthma. |
| Name | 3-(4-chlorophenyl)-1-propyl-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Arofylline is a PDE4 inhibitor as a potential treatment for asthma. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 562.6ºC at 760 mmHg |
| Molecular Formula | C14H13ClN4O2 |
| Molecular Weight | 304.73200 |
| Flash Point | 294ºC |
| Exact Mass | 304.07300 |
| PSA | 72.68000 |
| LogP | 1.93890 |
| Vapour Pressure | 1.1E-12mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | GVTLDPJNRVMCAL-UHFFFAOYSA-N |
| SMILES | CCCn1c(=O)c2[nH]cnc2n(-c2ccc(Cl)cc2)c1=O |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| UNII-87L38AY71R |
| 3-(4-chlorophenyl)-3,7-dihydro-1-propyl-1H-purine-2,6-dione |
| 1-n-propyl-3-(4-chlorophenyl)-xanthine |
| Arofyllin |
| 3-(4-chlorophenyl)-1-propyl-3,7-dihydro-1H-purine-2,6-dione |
| Arofylline (USAN/INN) |
| Arofylline |
| 3-(p-chlorophenyl)-1-propylxanthine |
| 3,7-dihydro-3-(4-chlorophenyl)-1-propyl-1H-purine-2,6-dione |