Boc-L-Glutamine structure
|
Common Name | Boc-L-Glutamine | ||
|---|---|---|---|---|
| CAS Number | 13726-85-7 | Molecular Weight | 246.260 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 509.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H18N2O5 | Melting Point | 114-117 ºC | |
| MSDS | Chinese USA | Flash Point | 261.7±28.7 °C | |
| Name | N-(tert-Butoxycarbonyl)-L-glutamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 509.1±45.0 °C at 760 mmHg |
| Melting Point | 114-117 ºC |
| Molecular Formula | C10H18N2O5 |
| Molecular Weight | 246.260 |
| Flash Point | 261.7±28.7 °C |
| Exact Mass | 246.121567 |
| PSA | 118.72000 |
| LogP | 0.11 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.495 |
| InChIKey | VVNYDCGZZSTUBC-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(N)=O)C(=O)O |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2924199090 |
|
~92%
Boc-L-Glutamine CAS#:13726-85-7 |
| Literature: Custot; Moali; Brollo; Boucher; Delaforge; Mansuy; Tenu; Zimmermann Journal of the American Chemical Society, 1997 , vol. 119, # 17 p. 4086 - 4087 |
|
~%
Boc-L-Glutamine CAS#:13726-85-7 |
| Literature: Monatshefte fuer Chemie, , vol. 105, p. 1110 - 1135 |
|
~%
Boc-L-Glutamine CAS#:13726-85-7 |
| Literature: Angewandte Chemie - International Edition, , vol. 47, # 29 p. 5456 - 5460 |
|
~%
Boc-L-Glutamine CAS#:13726-85-7 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 34, # 8 p. 3506 - 3509 |
|
~%
Boc-L-Glutamine CAS#:13726-85-7 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 716, p. 175 - 185 Justus Liebigs Annalen der Chemie, , vol. 743, p. 57 - 68 |
|
~%
Boc-L-Glutamine CAS#:13726-85-7 |
| Literature: Journal of the Chemical Society [Section] C: Organic, , p. 2632 - 2636 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Nα-tert-Butoxycarbonyl-L-glutamine |
| Boc-Gln-OH |
| EINECS 237-296-8 |
| Nα-Boc-L-glutamine |
| MFCD00065571 |
| TBOC-L-GLUTAMINE |
| 5-Amino-2-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)-5-oxopentanoic acid |
| N-Boc-glutamine |
| tert-butyloxycarbonyl-L-glutamine |
| Na-(tert-Butoxycarbonyl)-L-glutamine |
| N2-(tert-Butoxycarbonyl)-L-glutamine |
| Glutamine, N-[(1,1-dimethylethoxy)carbonyl]- |
| L-GLUTAMINE-N-T-BOC |
| (S)-5-Amino-2-((tert-butoxycarbonyl)amino)-5-oxopentanoic acid |
| N-(tert-Butoxycarbonyl)-L-glutamin |
| Nα-(tert-Butoxycarbonyl)-L-glutamine |
| BOC-L-GLN |
| Boc-D-Gln-OH |
| N-(tert-butoxycarbonyl)-L-glutamine |
| N-Boc-L-glutamine |
| BOC-GLUTAMINE |
| Boc-L-Glutamine |
| N-(tert-Butoxycarbonyl)glutamin |
| L-Glutamine, N-[(1,1-dimethylethoxy)carbonyl]- |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}glutamine |
| N-T-BOC-L-GLUTAMINE |
| BOC-L-GLN-OH |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-glutamine |
| BOC-GLN |
| BOC-Glycine |