YM 750 structure
|
Common Name | YM 750 | ||
|---|---|---|---|---|
| CAS Number | 138046-43-2 | Molecular Weight | 452.63000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H36N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of YM 750YM-750 is a potent acyl-CoA:cholesterol acyltransferase (ACAT) inhibitor (IC50=0.18 μM). ACAT catalyzes the formation of cholesteryl esters from cholesterol and long-chain fatty-acyl-coenzyme A[1][2]. |
| Name | 1-cycloheptyl-1-(9H-fluoren-2-ylmethyl)-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| Synonym | More Synonyms |
| Description | YM-750 is a potent acyl-CoA:cholesterol acyltransferase (ACAT) inhibitor (IC50=0.18 μM). ACAT catalyzes the formation of cholesteryl esters from cholesterol and long-chain fatty-acyl-coenzyme A[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Foam cells accumulated esterified cholesterol (EC) for 24 h in the presence of acLDL without Cu2+, which is suppressed by KY-455 and YM-750[3]. |
| References |
| Molecular Formula | C31H36N2O |
|---|---|
| Molecular Weight | 452.63000 |
| Exact Mass | 452.28300 |
| PSA | 35.83000 |
| LogP | 7.95350 |
| InChIKey | FMLJREWZCZHGGW-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(NC(=O)N(Cc2ccc3c(c2)Cc2ccccc2-3)C2CCCCCC2)c(C)c1 |
| ym 750 |