A 1070722 structure
|
Common Name | A 1070722 | ||
|---|---|---|---|---|
| CAS Number | 1384424-80-9 | Molecular Weight | 362.306 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 412.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H13F3N4O2 | Melting Point | N/A | |
| MSDS | Chinese | Flash Point | 203.3±28.7 °C | |
| Symbol |
GHS06 |
Signal Word | Danger | |
Use of A 1070722A 1070722 is a potent and selective glycogen synthase kinase 3 (GSK-3) inhibitor, with a Ki of 0.6 nM for both GSK-3α and GSK-3β. A 1070722 can penetrate the blood-brain barrier (BBB) and accumulates in brain regions, thus potential for PET radiotracer for the quantification of GSK-3 in brain[1]. |
| Name | 1-(7-Methoxy-4-quinolinyl)-3-[6-(trifluoromethyl)-2-pyridinyl]ure |
|---|---|
| Synonym | More Synonyms |
| Description | A 1070722 is a potent and selective glycogen synthase kinase 3 (GSK-3) inhibitor, with a Ki of 0.6 nM for both GSK-3α and GSK-3β. A 1070722 can penetrate the blood-brain barrier (BBB) and accumulates in brain regions, thus potential for PET radiotracer for the quantification of GSK-3 in brain[1]. |
|---|---|
| Related Catalog | |
| Target |
GSK-3α:0.6 nM (Ki) GSK-3β:0.6 nM (Ki) |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 412.5±45.0 °C at 760 mmHg |
| Molecular Formula | C17H13F3N4O2 |
| Molecular Weight | 362.306 |
| Flash Point | 203.3±28.7 °C |
| Exact Mass | 362.099060 |
| PSA | 79.63000 |
| LogP | 4.36 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | VQPBIJGXSXEOCU-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(NC(=O)Nc3cccc(C(F)(F)F)n3)ccnc2c1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H315-H319-H335 |
| Precautionary Statements | P261-P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2811 6.1 / PGIII |
| 1-(7-Methoxyquinolin-4-yl)-3-[6-(trifluoromethyl)pyridin-2-yl]urea |
| Zatebradine hydrochloride |
| 1-(7-Methoxy-4-quinolinyl)-3-[6-(trifluoromethyl)-2-pyridinyl]urea |
| A 1070722 |