N-(Tert-Butoxycarbonyl)-3-phenyl-D-phenylalanine structure
|
Common Name | N-(Tert-Butoxycarbonyl)-3-phenyl-D-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 138662-63-2 | Molecular Weight | 341.401 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 502.7±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H23NO4 | Melting Point | 160ºC (dec.) | |
| MSDS | USA | Flash Point | 257.8±30.1 °C | |
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,3-diphenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 502.7±50.0 °C at 760 mmHg |
| Melting Point | 160ºC (dec.) |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.401 |
| Flash Point | 257.8±30.1 °C |
| Exact Mass | 341.162720 |
| PSA | 75.63000 |
| LogP | 4.78 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | TYJDOLCFYZSNQC-KRWDZBQOSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)C(c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-β-phenyl- |
| N-(Tert-Butoxycarbonyl)-3-phenyl-D-phenylalanine |
| N-Boc-3,3-diphenyl-L-alanine |
| N-(tert-butoxycarbonyl)-3,3-diphenyl-L-alanine |
| N-tert-butoxycarbony-L-3,3-diphenylalanine |
| N-tert-butoxycarbonyl-(S)-diphenylalanine |
| (S)-2-(N-tert-butoxycarbonylamino)-3,3-diphenylpropanoic acid |
| L-2-t-butoxycarbonylamino-3,3-diphenylpropanoic acid |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-β-phenyl-L-phenylalanine |
| (2S)-2-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-3,3-diphenylpropanoic acid |
| N-(Tert-Butoxycarbonyl)-β-Phenyl-L-Phenylalanine |
| (S)-2-((tert-Butoxycarbonyl)amino)-3,3-diphenylpropanoic acid |
| (2S)-2-tert-butoxycarbonylamino-3,3-diphenyl-propionic acid |
| Boc-3,3-Diphenyl-L-alanine |
| Boc-L-3,3-Diphenylalanine |
| MFCD00191186 |
| N-(tert-Butoxycarbonyl)-b-phenyl-L-phenylalanine |
| (S)-N-Boc-2-amino-3,3-diphenylpropionicacid |
| Boc-diphenylalanine |
| N-(tert-Butoxycarbonyl)-β-phenyl-L-phenylalanin |