Golgicide A-1 structure
|
Common Name | Golgicide A-1 | ||
|---|---|---|---|---|
| CAS Number | 1394285-49-4 | Molecular Weight | 284.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14F2N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Golgicide A-1Golgicide A-1 (GCA-1) is a less active cis-diastereomer of Golgicide A (GCA). Golgicide A-1 weakly inhibits mosquito reproduction[1]. |
| Name | Golgicide A-1 |
|---|
| Description | Golgicide A-1 (GCA-1) is a less active cis-diastereomer of Golgicide A (GCA). Golgicide A-1 weakly inhibits mosquito reproduction[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Golgicide A-1 (GCA-1) displays minimal to no cytotoxicity in the Aedes aegypti and Anopheles stephensi larvae assay[1]. |
| References |
| Molecular Formula | C17H14F2N2 |
|---|---|
| Molecular Weight | 284.30 |
| InChIKey | NJZHEQOUHLZCOX-WOSRLPQWSA-N |
| SMILES | Fc1cc(F)c2c(c1)C1C=CCC1C(c1cccnc1)N2 |