2-chloro-4,6,8-trimethylquinoline structure
|
Common Name | 2-chloro-4,6,8-trimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 139719-24-7 | Molecular Weight | 205.68300 | |
| Density | 1.158g/cm3 | Boiling Point | 326.5ºC at 760mmHg | |
| Molecular Formula | C12H12ClN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-4,6,8-trimethylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 326.5ºC at 760mmHg |
| Molecular Formula | C12H12ClN |
| Molecular Weight | 205.68300 |
| Exact Mass | 205.06600 |
| PSA | 12.89000 |
| LogP | 3.81340 |
| Vapour Pressure | 0.000409mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | QELGNYILIXTHBQ-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2nc(Cl)cc(C)c2c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chlor-4,6,8-trimethyl-chinolin |
| F3284-7648 |
| 2-Chloro-4,6,8-trimethyl-quinoline |