2-nitro-4,5,7,8,9,10,11,12-octahydrobenzo[a]pyrene structure
|
Common Name | 2-nitro-4,5,7,8,9,10,11,12-octahydrobenzo[a]pyrene | ||
|---|---|---|---|---|
| CAS Number | 141511-28-6 | Molecular Weight | 305.37000 | |
| Density | 1.293g/cm3 | Boiling Point | 477ºC at 760mmHg | |
| Molecular Formula | C20H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.7ºC | |
| Name | 2-nitro-4,5,7,8,9,10,11,12-octahydrobenzo[a]pyrene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.293g/cm3 |
|---|---|
| Boiling Point | 477ºC at 760mmHg |
| Molecular Formula | C20H19NO2 |
| Molecular Weight | 305.37000 |
| Flash Point | 222.7ºC |
| Exact Mass | 305.14200 |
| PSA | 45.82000 |
| LogP | 4.86100 |
| Vapour Pressure | 8.4E-09mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | YKDMOHKMDIVHQS-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc2c3c(c1)CCc1c4c(cc(c1-3)CC2)CCCC4 |
|
~97%
2-nitro-4,5,7,8... CAS#:141511-28-6 |
| Literature: Miller, Dwight W.; Herreno-Saenz, Diogenes; Huang, Kurt H.; Heinze, Thomas M.; Fu, Peter P. Journal of Organic Chemistry, 1992 , vol. 57, # 13 p. 3746 - 3748 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| Benzo(a)pyrene,4,5,7,8,9,10,11,12-octahydro-2-nitro |
| 2-nitro-4,5,7,8,9,10,11,12-octahydrobenzo[pqr]tetraphene |
| 2-nitro-4,5,7,8,9,10,11,12-octahydrobenzo<a>pyrene |