9-Dihydro-13-acetylbaccatin III structure
|
Common Name | 9-Dihydro-13-acetylbaccatin III | ||
|---|---|---|---|---|
| CAS Number | 142203-65-4 | Molecular Weight | 630.68 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 601.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C33H42O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.0±25.0 °C | |
Use of 9-Dihydro-13-acetylbaccatin III9-Dihydro-13-acetylbaccatin III (9-DHAB III) is an intermediate for taxol analog preparations. IC50 value:Target: There are a series of closely related natural organic compounds isolated from the Pacific yew tree (Taxus brevifolia) and related species. Taxols have exhibit antitumor agents. 9-Dihydro-13-acetylbaccatin III is an antineoplastic agent and an anti-cancer intermediate. |
| Name | 13-Acetyl-9-dihydrobaccatin III |
|---|---|
| Synonym | More Synonyms |
| Description | 9-Dihydro-13-acetylbaccatin III (9-DHAB III) is an intermediate for taxol analog preparations. IC50 value:Target: There are a series of closely related natural organic compounds isolated from the Pacific yew tree (Taxus brevifolia) and related species. Taxols have exhibit antitumor agents. 9-Dihydro-13-acetylbaccatin III is an antineoplastic agent and an anti-cancer intermediate. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 601.4±55.0 °C at 760 mmHg |
| Molecular Formula | C33H42O12 |
| Molecular Weight | 630.68 |
| Flash Point | 193.0±25.0 °C |
| PSA | 148.82000 |
| LogP | 0.69 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | WPPPFZJNKLMYBW-FAEUQDRCSA-N |
| SMILES | CC(=O)OC1CC2(O)C(OC(=O)c3ccccc3)C3C4(OC(C)=O)COC4CC(O)C3(C)C(O)C(OC(C)=O)C(=C1C)C2(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| RIDADR | UN 1544 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 9-dehydro-13-acetylbaccatin III |
| 7,9-Dideacetyl baccatin VI |
| Ddabvi |
| (1β,5β,7β,9α,10β,13α)-1,7,9-Trihydroxy-5,20-epoxytax-11-ene-4,10,13-triyl triacetate |
| CS-1097 |
| 7,11-Methano-1H-cyclodeca[3,4]benz[1,2-b]oxete-4,5,6,9,11,12b-hexol, 2a,3,4,4a,5,6,9,10,12,12a-decahydro-4a,8,13,13-tetramethyl-, 6,9,12b-triacetate, (2aR,4S,4aS,5R,6R,9S,11R,12aS,12bS)- |
| 9-Dihydro-13-acetylbaccatin III |