N-[(2-chlorophenyl)carbamoyl]benzamide structure
|
Common Name | N-[(2-chlorophenyl)carbamoyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 142267-51-4 | Molecular Weight | 274.70200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(2-chlorophenyl)carbamoyl]benzamide |
|---|
| Molecular Formula | C14H11ClN2O2 |
|---|---|
| Molecular Weight | 274.70200 |
| Exact Mass | 274.05100 |
| PSA | 65.18000 |
| LogP | 3.89030 |
| InChIKey | JOQWBUNUUFAHKJ-UHFFFAOYSA-N |
| SMILES | O=C(NC(=O)c1ccccc1)Nc1ccccc1Cl |
|
~%
N-[(2-chlorophe... CAS#:142267-51-4 |
| Literature: Sah Journal of the Chinese Chemical Society (Peking), 1946 , vol. 13, p. 22,26,27 Recueil des Travaux Chimiques des Pays-Bas, 1940 , vol. 59, p. 231,233,234 |
|
~%
N-[(2-chlorophe... CAS#:142267-51-4 |
| Literature: Abrahart Journal of the Chemical Society, 1938 , p. 424 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |