1-Boc-4-(4-Bromobutyl)piperidine structure
|
Common Name | 1-Boc-4-(4-Bromobutyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 142355-81-5 | Molecular Weight | 320.26600 | |
| Density | 1.192g/cm3 | Boiling Point | 364.9ºC at 760mmHg | |
| Molecular Formula | C14H26BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | 1-Boc-4-(4-Bromobutyl)piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 364.9ºC at 760mmHg |
| Molecular Formula | C14H26BrNO2 |
| Molecular Weight | 320.26600 |
| Flash Point | 174.5ºC |
| Exact Mass | 319.11500 |
| PSA | 29.54000 |
| LogP | 4.13660 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | VRSNDRCACPSZIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCCBr)CC1 |
| HS Code | 2933399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| tert-butyl 4-(4-bromobutyl)piperidine-1-carboxylate |