1-Boc-4-(2-oxo-ethyl)piperidine structure
|
Common Name | 1-Boc-4-(2-oxo-ethyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 142374-19-4 | Molecular Weight | 227.300 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 318.1±15.0 °C at 760 mmHg | |
| Molecular Formula | C12H21NO3 | Melting Point | 38-42ºC | |
| MSDS | Chinese USA | Flash Point | 146.2±20.4 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | tert-Butyl 4-(2-oxoethyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.1±15.0 °C at 760 mmHg |
| Melting Point | 38-42ºC |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.300 |
| Flash Point | 146.2±20.4 °C |
| Exact Mass | 227.152145 |
| PSA | 46.61000 |
| LogP | 1.45 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | PSRHRFNKESVOEL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC=O)CC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
|
Enantioselective organo-SOMO catalysis: the alpha-vinylation of aldehydes.
J. Am. Chem. Soc. 130 , 398, (2008)
|
|
|
Tetrahedron Lett. 47 , 2515, (2006)
|
| 1-Boc-4-(2-oxo-ethyl)piperidine |
| 1-Piperidinecarboxylic acid, 4-(2-oxoethyl)-, 1,1-dimethylethyl ester |
| 4-(2-Oxoethyl)piperidine-1-carboxylic Acid tert-Butyl Ester |
| tert-Butyl 4-(2-oxoethyl)piperidine-1-carboxylate |
| 2-Methyl-2-propanyl 4-(2-oxoethyl)-1-piperidinecarboxylate |
| 2-(N-BOC-4-piperidinyl)acetaldehyde |