4-(1-Boc-4-piperidyl)-1-butanol structure
|
Common Name | 4-(1-Boc-4-piperidyl)-1-butanol | ||
|---|---|---|---|---|
| CAS Number | 142355-83-7 | Molecular Weight | 257.369 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 355.1±15.0 °C at 760 mmHg | |
| Molecular Formula | C14H27NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.6±20.4 °C | |
| Name | tert-butyl 4-(4-hydroxybutyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.1±15.0 °C at 760 mmHg |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.369 |
| Flash Point | 168.6±20.4 °C |
| Exact Mass | 257.199097 |
| PSA | 49.77000 |
| LogP | 2.14 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | GVOGVPFQDCQZNP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CCCCO)CC1 |
| HS Code | 2933399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Methyl-2-propanyl 4-(4-hydroxybutyl)-1-piperidinecarboxylate |
| 1-Piperidinecarboxylic acid, 4-(4-hydroxybutyl)-, 1,1-dimethylethyl ester |