2,3,5,6-Tetrafluorophenyl 2,2,2-trifluoroacetate structure
|
Common Name | 2,3,5,6-Tetrafluorophenyl 2,2,2-trifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 142685-25-4 | Molecular Weight | 262.08100 | |
| Density | 1.635g/cm3 | Boiling Point | 145.996ºC at 760 mmHg | |
| Molecular Formula | C8HF7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 41.681ºC | |
| Name | (2,3,5,6-tetrafluorophenyl) 2,2,2-trifluoroacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.635g/cm3 |
|---|---|
| Boiling Point | 145.996ºC at 760 mmHg |
| Molecular Formula | C8HF7O2 |
| Molecular Weight | 262.08100 |
| Flash Point | 41.681ºC |
| Exact Mass | 261.98600 |
| PSA | 26.30000 |
| LogP | 2.71070 |
| Vapour Pressure | 4.734mmHg at 25°C |
| Index of Refraction | 1.39 |
| InChIKey | OJLSSULCTKBVOB-UHFFFAOYSA-N |
| SMILES | O=C(Oc1c(F)c(F)cc(F)c1F)C(F)(F)F |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| 2,3,5,6-tetrafluorophenyl 2,2,2-trifluoroacetate |
| PC4314 |
| Acetic acid,trifluoro-,2,3,5,6-tetrafluorophenyl ester |
| 2,3,5,6-tetrafluorophenol trifluoroacetate |
| 2,3 5,6-Tetrafluorophenyl trifluoroacetate |
| tetrafluorophenyl trifluoroacetate |