4-Chloro-2-(trifluoromethyl)benzoic acid structure
|
Common Name | 4-Chloro-2-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 142994-09-0 | Molecular Weight | 224.564 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 264.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H4ClF3O2 | Melting Point | 110 °C | |
| MSDS | N/A | Flash Point | 113.9±27.3 °C | |
| Name | 4-Chloro-2-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 264.7±40.0 °C at 760 mmHg |
| Melting Point | 110 °C |
| Molecular Formula | C8H4ClF3O2 |
| Molecular Weight | 224.564 |
| Flash Point | 113.9±27.3 °C |
| Exact Mass | 223.985199 |
| PSA | 37.30000 |
| LogP | 3.82 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | RKZXXMAQKMOZLK-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cl)cc1C(F)(F)F |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | UN 3265 |
| HS Code | 2916399090 |
|
~%
4-Chloro-2-(tri... CAS#:142994-09-0 |
| Literature: US2006/14777 A1, ; Page/Page column 42 ; US 20060014777 A1 |
|
~%
4-Chloro-2-(tri... CAS#:142994-09-0 |
| Literature: EP487357 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzoic acid, 4-chloro-2-(trifluoromethyl)- |
| 4-Chloro-2-(trifluoromethyl)benzoic acid |
| 4-Chloro-α,α,α-trifluoro-o-toluic acid |
| QVR DG BXFFF |
| 4-chloro-2-trifluoromethylbenzoic acid |
| MFCD01631353 |