UWA-101 hydrochloride structure
|
Common Name | UWA-101 hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1431520-52-3 | Molecular Weight | 255.741 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of UWA-101 hydrochlorideUWA-101 (hydrochloride) is an analytical reference material that is structurally categorized as an amphetamine. |
| Name | UWA-101 (hydrochloride) |
|---|
| Molecular Formula | C13H18ClNO2 |
|---|---|
| Molecular Weight | 255.741 |
| InChIKey | RTPDALMALRMSMM-UHFFFAOYSA-N |
| SMILES | CNC(Cc1ccc2c(c1)OCO2)C1CC1.Cl |