7-Geranyloxy-5-methoxycoumarin structure
|
Common Name | 7-Geranyloxy-5-methoxycoumarin | ||
|---|---|---|---|---|
| CAS Number | 1432075-68-7 | Molecular Weight | 328.402 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 487.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2±28.8 °C | |
Use of 7-Geranyloxy-5-methoxycoumarin7-Geranyloxy-5-methoxycoumarin is a natural geranyloxycoumarin found in the twigs of Toddalia asiatica[1]. |
| Name | 7-Geranyloxy-5-methoxycoumarin |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Geranyloxy-5-methoxycoumarin is a natural geranyloxycoumarin found in the twigs of Toddalia asiatica[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 487.1±45.0 °C at 760 mmHg |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.402 |
| Flash Point | 213.2±28.8 °C |
| Exact Mass | 328.167450 |
| PSA | 48.67000 |
| LogP | 5.97 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | ORBVONLAJRGOAY-XNTDXEJSSA-N |
| SMILES | COc1cc(OCC=C(C)CCC=C(C)C)cc2oc(=O)ccc12 |
| Hazard Codes | Xi |
|---|
| 7-{[(2E)-3,7-Dimethyl-2,6-octadien-1-yl]oxy}-5-methoxy-2H-chromen-2-one |
| 2H-1-Benzopyran-2-one, 7-[[(2E)-3,7-dimethyl-2,6-octadien-1-yl]oxy]-5-methoxy- |