Furaltadone L-tartrate structure
|
Common Name | Furaltadone L-tartrate | ||
|---|---|---|---|---|
| CAS Number | 14343-71-6 | Molecular Weight | 474.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H22N4O12 | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
Use of Furaltadone L-tartrateFuraltadone L-tartrate (Altafur L-tartrate), a nitrofuran drug, has the potential for the study in infections of chickens with salmonella enteritidis. Furaltadone is inhibitory and bactericidal in vitro for staphylococci [1][2]. |
| Name | Furaltadone (+)-tartrate salt |
|---|---|
| Synonym | More Synonyms |
| Description | Furaltadone L-tartrate (Altafur L-tartrate), a nitrofuran drug, has the potential for the study in infections of chickens with salmonella enteritidis. Furaltadone is inhibitory and bactericidal in vitro for staphylococci [1][2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H22N4O12 |
|---|---|
| Molecular Weight | 474.37600 |
| Exact Mass | 474.12300 |
| PSA | 228.39000 |
| InChIKey | NUQMJOZPYRELIB-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)C(O)C(=O)O.O=C1OC(CN2CCOCC2)CN1N=Cc1ccc([N+](=O)[O-])o1 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H351 |
| Precautionary Statements | P281 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| RIDADR | UN 3249 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| 5-(4-Morpholinylmethyl)-3-{(E)-[(5-nitro-2-furyl)methylene]amino} -1,3-oxazolidin-2-one 2,3-dihydroxysuccinate (1:1) |