(+)-Dehydroabiethylamine structure
|
Common Name | (+)-Dehydroabiethylamine | ||
|---|---|---|---|---|
| CAS Number | 1446-61-3 | Molecular Weight | 285.467 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 382.9±11.0 °C at 760 mmHg | |
| Molecular Formula | C20H31N | Melting Point | 44.50℃ | |
| MSDS | Chinese USA | Flash Point | 156.7±9.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of (+)-DehydroabiethylamineLeelamine is a weak agonist of cannabinoid receptors CB1 and CB2. Leelamine also inhibits pyruvate dehydrogenase kinases (PDKs). Leelamine exhibits anti-tumor activity[1]. |
| Name | dehydroabietylamine |
|---|---|
| Synonym | More Synonyms |
| Description | Leelamine is a weak agonist of cannabinoid receptors CB1 and CB2. Leelamine also inhibits pyruvate dehydrogenase kinases (PDKs). Leelamine exhibits anti-tumor activity[1]. |
|---|---|
| Related Catalog | |
| Target |
CB1 CB2 |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.9±11.0 °C at 760 mmHg |
| Melting Point | 44.50℃ |
| Molecular Formula | C20H31N |
| Molecular Weight | 285.467 |
| Flash Point | 156.7±9.1 °C |
| Exact Mass | 285.245636 |
| PSA | 26.02000 |
| LogP | 6.40 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | JVVXZOOGOGPDRZ-SLFFLAALSA-N |
| SMILES | CC(C)c1ccc2c(c1)CCC1C(C)(CN)CCCC21C |
| Storage condition | Desiccate at +4°C |
CHEMICAL IDENTIFICATION
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive;Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | TP8701000 |
| HS Code | 3806900090 |
|
~%
(+)-Dehydroabie... CAS#:1446-61-3 |
| Literature: Svensk Kemisk Tidskrift, , vol. 66, p. 316,321 |
|
~%
(+)-Dehydroabie... CAS#:1446-61-3 |
| Literature: Zhurnal Organicheskoi Khimii, , vol. 9, p. 756 - 758,778 - 780 |
|
~%
(+)-Dehydroabie... CAS#:1446-61-3 |
| Literature: Tetrahedron, , vol. 53, # 42 p. 14355 - 14368 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis of Tertiary and Quaternary Amine Derivatives from Wood Resin as Chiral NMR Solvating Agents.
Molecules 20 , 20873-86, (2015) Chiral tertiary and quaternary amine solvating agents for NMR spectroscopy were synthesized from the wood resin derivative (+)-dehydroabietylamine (2). The resolution of enantiomers of model compounds... |
| Leelamine hydrochloride,(1R,4aS,10aR)-1,2,3,4,4a,9,10,10a-Octahydro-1-,4a-dimethyl-7-(1-methylethyl)-1-phenanthrenemethanaminehydrochloride |
| EINECS 215-899-7 |
| MFCD00213430 |
| (+)-DehydroabietylaMine [Optical Resolving Agent] |
| Dehydroabiethylamine |