Comins' Reagent structure
|
Common Name | Comins' Reagent | ||
|---|---|---|---|---|
| CAS Number | 145100-51-2 | Molecular Weight | 392.683 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 358.3±52.0 °C at 760 mmHg | |
| Molecular Formula | C7H3ClF6N2O4S2 | Melting Point | 45-47 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 170.5±30.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(5-Chloro-2-pyridyl)bis(trifluoromethanesulfonimide) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 358.3±52.0 °C at 760 mmHg |
| Melting Point | 45-47 °C(lit.) |
| Molecular Formula | C7H3ClF6N2O4S2 |
| Molecular Weight | 392.683 |
| Flash Point | 170.5±30.7 °C |
| Exact Mass | 391.912689 |
| PSA | 101.17000 |
| LogP | 2.68 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | TUFGVZMNGTYAQD-UHFFFAOYSA-N |
| SMILES | O=S(=O)(N(c1ccc(Cl)cn1)S(=O)(=O)C(F)(F)F)C(F)(F)F |
| Storage condition | Keep Cold |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2935009090 |
|
~82%
Comins' Reagent CAS#:145100-51-2 |
| Literature: Comins, Daniel L.; Dehghani, Ali Tetrahedron Letters, 1992 , vol. 33, # 42 p. 6299 - 6302 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Total synthesis of the antimitotic marine macrolide (-)-leiodermatolide.
Angew. Chem. Int. Ed. Engl. 53(10) , 2692-5, (2014) Leiodermatolide is an antimitotic macrolide isolated from the marine sponge Leiodermatium sp. whose potentially novel tubulin-targeting mechanism of action makes it an exciting lead for anticancer dru... |
|
|
Tetrahedron Lett. 33 , 6299, (1992)
|
|
|
Tetrahedron Lett. 44 , 9185, (2003)
|
| 2-[N,N-Bis(trifluoromethanesulfonyl)amino]-5-chloropyridine |
| N-(5-chloropyridin-2-yl)-1,1,1-trifluoro-N-(trifluoromethylsulfonyl)methanesulfonamide |
| N-(5-Chloropyridin-2-yl)-1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide |
| 2-(N,N-Bis(trifluoromethylsulfonyl)amino]-5-chloropyridine |
| N-(5-Chloro-2-pyridyl)bis(trifluoromethanesulf |
| N-(5-Chloro-2-pyridyl)triflimide |
| MFCD00191833 |
| N-(5-Chloro-2-pyridyl)bis(trifluoromethanesulfonyl)imide |
| N-(5-Chloro-2-pyridyl)bis(trifluoromethanesulfonimide) |
| Comins Triflating |
| 2-[N,N-Bis(Trifluoromethylsulphonyl)amino]-5-chloropyridine |
| Comins' Reagent |
| Methanesulfonamide, N-(5-chloro-2-pyridinyl)-1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]- |
| N-(5-Chloro-2-pyridinyl)-1,1,1-trifluoro-N-[(trifluoromethyl)sulfonyl]methanesulfonamide |