TRAP-7 trifluoroacetate salt
Modify Date: 2025-09-11 13:17:11
TRAP-7 trifluoroacetate salt structure
|
Common Name | TRAP-7 trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 145229-76-1 | Molecular Weight | 845.98500 | |
| Density | 1.41 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C39H63N11O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TRAP-7 trifluoroacetate saltTRAP-7 is a thrombin receptor (PAR) activating peptide. TRAP-7 stimulates total inositol phosphate (IP) accumulation and phosphorylation of a specific endogenous substrate for activated PKC. TRAP-7 can be used in cardiovascular disease research[1]. |
| Name | h-ser-phe-leu-leu-arg-asn-pro-oh |
|---|---|
| Synonym | More Synonyms |
| Description | TRAP-7 is a thrombin receptor (PAR) activating peptide. TRAP-7 stimulates total inositol phosphate (IP) accumulation and phosphorylation of a specific endogenous substrate for activated PKC. TRAP-7 can be used in cardiovascular disease research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.41 g/cm3 |
|---|---|
| Molecular Formula | C39H63N11O10 |
| Molecular Weight | 845.98500 |
| Exact Mass | 845.47600 |
| PSA | 354.35000 |
| LogP | 1.76310 |
| Index of Refraction | 1.64 |
| InChIKey | FHZSIZRTNHGLSX-FLMSMKGQSA-N |
| SMILES | CC(C)CC(NC(=O)C(Cc1ccccc1)NC(=O)C(N)CO)C(=O)NC(CC(C)C)C(=O)NC(CCCN=C(N)N)C(=O)NC(CC(N)=O)C(=O)N1CCCC1C(=O)O |
| thrombinreceptorpeptidesfllrnp |
| SER-PHE-LEU-LEU-ARG-ASN-PRO |
| SFLLRNP |