4-Nitroacetophenone structure
|
Common Name | 4-Nitroacetophenone | ||
|---|---|---|---|---|
| CAS Number | 1460-05-5 | Molecular Weight | 217.262 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 306.4±21.0 °C at 760 mmHg | |
| Molecular Formula | C10H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.1±22.1 °C | |
| Name | 2-(4-nitrophenyl)acetaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 306.4±21.0 °C at 760 mmHg |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.262 |
| Flash Point | 139.1±22.1 °C |
| Exact Mass | 217.131409 |
| PSA | 62.89000 |
| LogP | 1.94 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.468 |
| InChIKey | NDXLKCBBPVHYSO-UHFFFAOYSA-N |
| SMILES | O=CCc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2913000090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 4'-Nitroacetophenone |
| 2-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| Ethanone, 1-(4-nitrophenyl)- |
| N,2-Dimethyl-N-{[(2-methyl-2-propanyl)oxy]carbonyl}alanine |
| 4-Nitroacetophenone |
| 2-(4-nitrophenyl)ethanal |
| 1-(4-Nitrophenyl)ethanone |
| Benzeneacetaldehyde,4-nitro |
| 4-nitrophenylethanal |
| p-nitrophenylacetaldehyde |
| (4-NITRO-PHENYL)-ACETALDEHYDE |
| Alanine, N-[(1,1-dimethylethoxy)carbonyl]-N,2-dimethyl- |
| 4-Nitro-Benzeneacetaldehyde |