5'-DMT-2'-F-dU structure
|
Common Name | 5'-DMT-2'-F-dU | ||
|---|---|---|---|---|
| CAS Number | 146954-74-7 | Molecular Weight | 548.559 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C30H29FN2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-DMT-2'-F-dU2'-Deoxy-5'-O-DMT-2'-fluorouridine, a nucleoside analogue, is a 5’-O-DMTr-5-FUDR derivative with potent anti-yellow fever (YFV) activity[1]. |
| Name | 1-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluoro-4-hydroxyoxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Description | 2'-Deoxy-5'-O-DMT-2'-fluorouridine, a nucleoside analogue, is a 5’-O-DMTr-5-FUDR derivative with potent anti-yellow fever (YFV) activity[1]. |
|---|---|
| Related Catalog | |
| In Vitro | 2'-Deoxy-5'-O-DMT-2'-fluorouridine (compound 15h) has 100% inhibition against YFV at 20 mM. 2'-Deoxy-5'-O-DMT-2'-fluorouridine proves to be noncytotoxic at concen-trations up to 20 mM[1]. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C30H29FN2O7 |
| Molecular Weight | 548.559 |
| Exact Mass | 548.195862 |
| PSA | 112.01000 |
| LogP | 4.83 |
| Appearance of Characters | Powder | White to Pale Yellow |
| Index of Refraction | 1.647 |
| InChIKey | CSSFZSSZXOCCJB-YULOIDQLSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3ccc(=O)[nH]c3=O)C(F)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| Hazard Codes | Xi |
|---|
|
~94%
5'-DMT-2'-F-dU CAS#:146954-74-7 |
| Literature: Helvetica Chimica Acta, , vol. 80, # 6 p. 1952 - 1971 |
|
~%
5'-DMT-2'-F-dU CAS#:146954-74-7 |
| Literature: WO2003/99840 A1, ; Page 222 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 5'-O-[Bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy-2'-fluoro-uridine |
| DMT-2'-F-dU |
| 5'-O-[Bis(4-methoxyphenyl)(phenyl)methyl]-2'-deoxy-2'-fluorouridine |
| Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-deoxy-2'-fluoro- |
| HG1172 |
| 5'-O-(4,4'-Dimethoxytrityl)-2'-fluoro-2'-deoxyuridine |
| 5'-DMT-2'-F-dU |