tert-Butyl methylsulfonylcarbamate structure
|
Common Name | tert-Butyl methylsulfonylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 147751-16-4 | Molecular Weight | 195.237 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl N-methylsulfonylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C6H13NO4S |
| Molecular Weight | 195.237 |
| Exact Mass | 195.056534 |
| PSA | 80.85000 |
| LogP | 0.34 |
| Index of Refraction | 1.461 |
| InChIKey | GAIZFMKSOHADOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NS(C)(=O)=O |
| HS Code | 2935009090 |
|---|
|
~90%
tert-Butyl meth... CAS#:147751-16-4 |
| Literature: Neustadt, Bernard R. Tetrahedron Letters, 1994 , vol. 35, # 3 p. 379 - 380 |
|
~86%
Detail
|
| Literature: Eli Lilly and Company Patent: US6358981 B1, 2002 ; Location in patent: Page column 22 ; US 6358981 B1 |
|
~%
tert-Butyl meth... CAS#:147751-16-4 |
| Literature: Journal of Organic Chemistry, , vol. 58, # 10 p. 2900 - 2903 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| N-Boc-methylsulfonamide |
| Carbamic acid, N-(methylsulfonyl)-, 1,1-dimethylethyl ester |
| tert-Butyl (methylsulfonyl)carbamate |
| TERT-BUTYL N-METHANESULFONYLCARBAMATE |
| N-(t-butoxycarbonyl)methanesulfonamide |
| tert-butyl methylsulfonylcarbamate |
| N-(tert-butoxycarbonyl)methylsulfonamide |
| N-(tert-butoxycarbonyl)methanesulfonamide |
| 2-Methyl-2-propanyl (methylsulfonyl)carbamate |