1-Chloro-2,4-difluoro-5-nitrobenzene structure
|
Common Name | 1-Chloro-2,4-difluoro-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 1481-68-1 | Molecular Weight | 193.535 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 239.0±35.0 °C at 760 mmHg | |
| Molecular Formula | C6H2ClF2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 98.4±25.9 °C | |
| Name | 2,4-Difluoro-5-Chloronitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 239.0±35.0 °C at 760 mmHg |
| Molecular Formula | C6H2ClF2NO2 |
| Molecular Weight | 193.535 |
| Flash Point | 98.4±25.9 °C |
| Exact Mass | 192.974213 |
| PSA | 45.82000 |
| LogP | 2.33 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | UIOYEIHBWQTVJC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Cl)c(F)cc1F |
| Hazard Codes | Xi |
|---|
|
~68%
1-Chloro-2,4-di... CAS#:1481-68-1 |
| Literature: Abbott Laboratories Patent: US5576455 A1, 1996 ; |
|
~%
1-Chloro-2,4-di... CAS#:1481-68-1 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 2593,2596 |
|
~%
1-Chloro-2,4-di... CAS#:1481-68-1 |
| Literature: Journal of the American Chemical Society, , vol. 78, p. 2593,2596 |
| Benzene, 1-chloro-2,4-difluoro-5-nitro- |
| EINECS 216-040-9 |
| 1-Chloro-2,4-difluoro-5-nitrobenzene |
| MFCD06658249 |
| 5-Chloro-2,4-Difluoronitrobenzene |