(S)-2-(3-chloro-2-hydroxypropyl)isoindoline-1,3-dione structure
|
Common Name | (S)-2-(3-chloro-2-hydroxypropyl)isoindoline-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 148857-42-5 | Molecular Weight | 239.655 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 405.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.0±25.9 °C | |
| Name | 2-[(2S)-3-Chloro-2-hydroxypropyl]-1H-isoindole-1,3(2H)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 405.4±35.0 °C at 760 mmHg |
| Molecular Formula | C11H10ClNO3 |
| Molecular Weight | 239.655 |
| Flash Point | 199.0±25.9 °C |
| Exact Mass | 239.034927 |
| PSA | 57.61000 |
| LogP | 1.63 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.616 |
| InChIKey | KBRVYEPWGIQEOF-SSDOTTSWSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1CC(O)CCl |
| Hazard Codes | T+ |
|---|
|
~74%
(S)-2-(3-chloro... CAS#:148857-42-5 |
| Literature: Tammana, Rajesh; Vemula, Kiran Kumar; Guruvindapalli, Ramadasu; Yanamandr, Ramesh; Gutta, Madhusudhan Arkivoc, 2012 , vol. 2012, # 6 p. 45 - 56 |
|
~%
(S)-2-(3-chloro... CAS#:148857-42-5 |
| Literature: Pharmacia and Upjohn Company Patent: US6362334 B1, 2002 ; Location in patent: Example 4 ; |
|
~82%
(S)-2-(3-chloro... CAS#:148857-42-5 |
| Literature: Pace, Vittorio; Hoyos, Pilar; Fernandez, Maria; Sinisterra, Jose V.; Alcantara, Andres R. Green Chemistry, 2010 , vol. 12, # 8 p. 1380 - 1382 |
|
~%
(S)-2-(3-chloro... CAS#:148857-42-5 |
| Literature: Martinez Lagos, Fernando; Carballeira, Jose D.; Bermudez, Jose L.; Alvarez, Emilio; Sinisterra, Jose V. Tetrahedron Asymmetry, 2004 , vol. 15, # 5 p. 763 - 770 |
| 3-chloro-1-phenylmethylamino-2-hydroxypropane |
| N-(3-chloro-2-hydroxypropyl)phthalimide |
| (-)-2-(3-chloro-2-hydroxypropyl)-1H-isoindole-1,3(2H)-dione |
| 1-(N-benzyl)amino-3-chloro-2-propanol |
| (RS)-1-chloro-3-phthalimidopropan-2-ol |
| 1-(benzylamino)-3-chloro-2-propanol |
| 1-chloro-3-benzylpropan-2-ol |
| 2-Propanol,1-chloro-3-[(phenylmethyl)amino] |
| (+/-)-1-chloro-3-phthalimido-2-propanol |
| (S)-1-phthalimido-3-chloro-2-propanol |
| 1H-Isoindole-1,3(2H)-dione, 2-[(2S)-3-chloro-2-hydroxypropyl]- |
| 2-[(2S)-3-Chloro-2-hydroxypropyl]-1H-isoindole-1,3(2H)-dione |
| rac-1-phthalimido-3-chloro-2-propanol |
| N-(3-chloro-2-hydroxypropyl)benzylamine |
| 1-(benzylamino)-3-chloropropan-2-ol |
| N-benzyl-3-chloro-2-hydroxypropylamine |
| 3-(Benzylamino)-1-chloro-2-propanol |
| (S)-2-(3-chloro-2-hydroxypropyl)isoindoline-1,3-dione |
| Rivaroxaban Impurity 53 |