2-piperidino-5-(trifluoromethyl)aniline structure
|
Common Name | 2-piperidino-5-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 1496-40-8 | Molecular Weight | 244.256 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 332.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H15F3N2 | Melting Point | 41 °C | |
| MSDS | N/A | Flash Point | 154.7±27.9 °C | |
| Name | n-(2-amino-4-trifluoromethylphenyl)piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 332.2±42.0 °C at 760 mmHg |
| Melting Point | 41 °C |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.256 |
| Flash Point | 154.7±27.9 °C |
| Exact Mass | 244.118729 |
| PSA | 29.26000 |
| LogP | 3.83 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.523 |
| InChIKey | BERRRZOJDANPHE-UHFFFAOYSA-N |
| SMILES | Nc1cc(C(F)(F)F)ccc1N1CCCCC1 |
| Hazard Codes | Xi,F |
|---|---|
| Risk Phrases | R10:Flammable. R37:Irritating to the respiratory system. |
| Safety Phrases | S23-S24/25 |
| RIDADR | UN 1224 3/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 3 |
| HS Code | 2933399090 |
|
~88%
2-piperidino-5-... CAS#:1496-40-8 |
| Literature: HAGIWARA, Masatoshi Patent: EP1712242 A1, 2006 ; Location in patent: Page/Page column 18; 30 ; |
|
~%
2-piperidino-5-... CAS#:1496-40-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 50, # 4 p. 627 - 640 |
|
~%
2-piperidino-5-... CAS#:1496-40-8 |
| Literature: Journal of Medicinal Chemistry, , vol. 50, # 4 p. 627 - 640 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzenamine, 2-(1-piperidinyl)-5-(trifluoromethyl)- |
| 3-AMINO-4-(1-PIPERIDINO)BENZOTRIFLUORIDE |
| 2-piperidin-1-yl-5-trifluoromethyl-aniline |
| MFCD00042161 |
| 2-piperidin-1-yl-5-(trifluoromethyl)aniline |
| 2-(piperidin-1-yl)-5-(trifluoromethyl)benzenamine |
| 2-piperidine-1-yl-5-trifluoromethyl-phenylamine |
| 2-(1-Piperidinyl)-5-(trifluoromethyl)aniline |
| 2-(piperidin-1-yl)-5-(trifluoromethyl)aniline |
| 2-piperidino-5-(trifluoromethyl)aniline |
| N-<2-Amino-4-trifluormethyl-phenyl>-piperidin |
| AKOS BB-8562 |
| 3-AMINO-4-PIPERIDINOBENZOTRIFLUORIDE |