Levamlodipine besylate structure
|
Common Name | Levamlodipine besylate | ||
|---|---|---|---|---|
| CAS Number | 150566-71-5 | Molecular Weight | 567.05 | |
| Density | 1.228 g/cm3 | Boiling Point | 527.161ºC at 760 mmHg | |
| Molecular Formula | C26H31ClN2O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.617ºC | |
Use of Levamlodipine besylateLevamlodipine besylate ((S)-Amlodipine besylate) is a powerful dihydropyridine calcium channel blocker, possessing vasodilation properties and used in the treatment of hypertension and angina[1]. |
| Name | S-Amlodipine |
|---|---|
| Synonym | More Synonyms |
| Description | Levamlodipine besylate ((S)-Amlodipine besylate) is a powerful dihydropyridine calcium channel blocker, possessing vasodilation properties and used in the treatment of hypertension and angina[1]. |
|---|---|
| Related Catalog | |
| Target |
Calcium channel[1]. |
| References |
| Density | 1.228 g/cm3 |
|---|---|
| Boiling Point | 527.161ºC at 760 mmHg |
| Molecular Formula | C26H31ClN2O8S |
| Molecular Weight | 567.05 |
| Flash Point | 272.617ºC |
| Exact Mass | 566.14900 |
| PSA | 162.63000 |
| LogP | 5.30950 |
| InChIKey | ZPBWCRDSRKPIDG-LMOVPXPDSA-N |
| SMILES | CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)C1c1ccccc1Cl.O=S(=O)(O)c1ccccc1 |
| Storage condition | 2-8℃ |
| S-amlodipine benzenesulfonic acid |
| Ameisensaeure,Samariumformiat |
| levamlodipine benzenesulfonate |
| formic acid,samarium formate |
| S-amlodipine benzenesulfonate |