Dimethyl 2-(2-nitrophenyl)malonate structure
|
Common Name | Dimethyl 2-(2-nitrophenyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 26465-37-2 | Molecular Weight | 253.20800 | |
| Density | 1.323g/cm3 | Boiling Point | 364.4ºC at 760mmHg | |
| Molecular Formula | C11H11NO6 | Melting Point | 48-50ºC | |
| MSDS | N/A | Flash Point | 159.2ºC | |
| Name | dimethyl 2-(2-nitrophenyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 364.4ºC at 760mmHg |
| Melting Point | 48-50ºC |
| Molecular Formula | C11H11NO6 |
| Molecular Weight | 253.20800 |
| Flash Point | 159.2ºC |
| Exact Mass | 253.05900 |
| PSA | 98.42000 |
| LogP | 1.54760 |
| Vapour Pressure | 1.68E-05mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | YDGNTNNTVUTSQE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)OC)c1ccccc1[N+](=O)[O-] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2917399090 |
|
~%
Dimethyl 2-(2-n... CAS#:26465-37-2 |
| Literature: Sriramurthy, Vardhineedi; Kwon, Ohyun Organic Letters, 2010 , vol. 12, # 5 p. 1084 - 1087 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| (2-Nitro-phenyl)-malonsaeure-dimethylester |
| dimethyl 2-(2-nitrophenyl)malonate |
| dimethyl(2-nitrophenyl)malonate |
| dimethyl 2-(2-nitrophenyl)propane-1,3-dioate |
| HMS2315L07 |